C36H38N6O2 — CID 138649511
N-[2-(dimethylamino)ethyl]-4-[6-[2-(4-pentoxyphenyl)-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]benzamide (PubChem CID 138649511) has the molecular formula C36H38N6O2 and a molecular weight of 586.74 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[6-[2-(4-pentoxyphenyl)-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[6-[2-(4-pentoxyphenyl)-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 138649511 |
| Molecular Formula | C36H38N6O2 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[6-[2-(4-pentoxyphenyl)-3H-benzimidazol-5-yl]-1H-benzimidazol-2-yl]benzamide |
| SMILES | CCCCCOc1ccc(-c2nc3ccc(-c4ccc5nc(-c6ccc(C(=O)NCCN(C)C)cc6)[nH]c5c4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C36H38N6O2/c1-4-5-6-21-44-29-15-11-25(12-16-29)35-39-31-18-14-28(23-33(31)41-35)27-13-17-30-32(22-27)40-34(38-30)24-7-9-26(10-8-24)36(43)37-19-20-42(2)3/h7-18,22-23H,4-6,19-21H2,1-3H3,(H,37,43)(H,38,40)(H,39,41) |
| InChIKey | ZOCDVILSGUYPNI-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|