C27H29N3O2 — CID 3131474
N-[3-(1H-benzimidazol-2-yl)phenyl]-4-heptoxybenzamide (PubChem CID 3131474) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)phenyl]-4-heptoxybenzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)phenyl]-4-heptoxybenzamide |
|---|---|
| PubChem CID | 3131474 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)phenyl]-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2cccc(-c3nc4ccccc4[nH]3)c2)cc1 |
| InChI | InChI=1S/C27H29N3O2/c1-2-3-4-5-8-18-32-23-16-14-20(15-17-23)27(31)28-22-11-9-10-21(19-22)26-29-24-12-6-7-13-25(24)30-26/h6-7,9-17,19H,2-5,8,18H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | PRGXYPJHHZSXSQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|