C25H25N3O2 — CID 3114141
N-[5-(1H-benzimidazol-2-yl)-2-methylphenyl]-3-butoxybenzamide (PubChem CID 3114141) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[5-(1H-benzimidazol-2-yl)-2-methylphenyl]-3-butoxybenzamide.
| Compound Name | N-[5-(1H-benzimidazol-2-yl)-2-methylphenyl]-3-butoxybenzamide |
|---|---|
| PubChem CID | 3114141 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N-[5-(1H-benzimidazol-2-yl)-2-methylphenyl]-3-butoxybenzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2cc(-c3nc4ccccc4[nH]3)ccc2C)c1 |
| InChI | InChI=1S/C25H25N3O2/c1-3-4-14-30-20-9-7-8-19(15-20)25(29)28-23-16-18(13-12-17(23)2)24-26-21-10-5-6-11-22(21)27-24/h5-13,15-16H,3-4,14H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | ACFBQTGDVXEKMA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|