C29H29N3O — CID 15410383
N-[3-(dimethylamino)propyl]-4-(2,6-diphenyl-4-pyridinyl)benzamide (PubChem CID 15410383) has the molecular formula C29H29N3O and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-(2,6-diphenyl-4-pyridinyl)benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-(2,6-diphenyl-4-pyridinyl)benzamide |
|---|---|
| PubChem CID | 15410383 |
| Molecular Formula | C29H29N3O |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-(2,6-diphenyl-4-pyridinyl)benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H29N3O/c1-32(2)19-9-18-30-29(33)25-16-14-22(15-17-25)26-20-27(23-10-5-3-6-11-23)31-28(21-26)24-12-7-4-8-13-24/h3-8,10-17,20-21H,9,18-19H2,1-2H3,(H,30,33) |
| InChIKey | GISDTYGJRKRMJJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|