C13H19ClN2O3 — CID 163333032
4-[3-(dimethylamino)propylcarbamoyl]benzoic acid;hydrochloride (PubChem CID 163333032) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propylcarbamoyl]benzoic acid;hydrochloride.
| Compound Name | 4-[3-(dimethylamino)propylcarbamoyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 163333032 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-[3-(dimethylamino)propylcarbamoyl]benzoic acid;hydrochloride |
| SMILES | CN(C)CCCNC(=O)c1ccc(C(=O)O)cc1.Cl |
| InChI | InChI=1S/C13H18N2O3.ClH/c1-15(2)9-3-8-14-12(16)10-4-6-11(7-5-10)13(17)18;/h4-7H,3,8-9H2,1-2H3,(H,14,16)(H,17,18);1H |
| InChIKey | PGHDVPDYOZYEIO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|