C13H18F2N2O2 — CID 14959961
4-(difluoromethoxy)-N-[3-(dimethylamino)propyl]benzamide (PubChem CID 14959961) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[3-(dimethylamino)propyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-N-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 14959961 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-(difluoromethoxy)-N-[3-(dimethylamino)propyl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H18F2N2O2/c1-17(2)9-3-8-16-12(18)10-4-6-11(7-5-10)19-13(14)15/h4-7,13H,3,8-9H2,1-2H3,(H,16,18) |
| InChIKey | IVSXZRWHFUSMOW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|