C13H17F2N3O3 — CID 77036856
N-(5-amino-5-hydroxyiminopentyl)-4-(difluoromethoxy)benzamide (PubChem CID 77036856) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is N-(5-amino-5-hydroxyiminopentyl)-4-(difluoromethoxy)benzamide.
| Compound Name | N-(5-amino-5-hydroxyiminopentyl)-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 77036856 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-(5-amino-5-hydroxyiminopentyl)-4-(difluoromethoxy)benzamide |
| SMILES | NC(CCCCNC(=O)c1ccc(OC(F)F)cc1)=NO |
| InChI | InChI=1S/C13H17F2N3O3/c14-13(15)21-10-6-4-9(5-7-10)12(19)17-8-2-1-3-11(16)18-20/h4-7,13,20H,1-3,8H2,(H2,16,18)(H,17,19) |
| InChIKey | XURMIXSDIBRIEQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|