C14H21N3O2 — CID 77036912
N-(5-amino-5-hydroxyiminopentyl)-3,4-dimethylbenzamide (PubChem CID 77036912) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(5-amino-5-hydroxyiminopentyl)-3,4-dimethylbenzamide.
| Compound Name | N-(5-amino-5-hydroxyiminopentyl)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 77036912 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | N-(5-amino-5-hydroxyiminopentyl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCCCC(N)=NO)cc1C |
| InChI | InChI=1S/C14H21N3O2/c1-10-6-7-12(9-11(10)2)14(18)16-8-4-3-5-13(15)17-19/h6-7,9,19H,3-5,8H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | JAHQXIKLYLKAFJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|