About N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide
N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide (PubChem CID 77036928) has the molecular formula C12H14F3N3O2
and a molecular weight of 289.26 g/mol. Its IUPAC name is N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide.
Molecular Properties
| Compound Name | N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide |
| PubChem CID | 77036928 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide |
| SMILES | NC(CCCCNC(=O)c1cc(F)c(F)c(F)c1)=NO |
| InChI | InChI=1S/C12H14F3N3O2/c13-8-5-7(6-9(14)11(8)15)12(19)17-4-2-1-3-10(16)18-20/h5-6,20H,1-4H2,(H2,16,18)(H,17,19) |
| InChIKey | NDUYKDCJRDXEDX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|
Analyze N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide?
The IUPAC name of N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide (CID 77036928) is N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide.
What is the SMILES notation for N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide?
The canonical SMILES for N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide is NC(CCCCNC(=O)c1cc(F)c(F)c(F)c1)=NO.
What is the InChIKey of N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide?
The InChIKey is NDUYKDCJRDXEDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N3O2/c13-8-5-7(6-9(14)11(8)15)12(19)17-4-2-1-3-10(16)18-20/h5-6,20H,1-4H2,(H2,16,18)(H,17,19).
What are the key properties of N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide?
N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide has a molecular weight of 289.26 g/mol, XLogP of 1.75, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-5-hydroxyiminopentyl)-3,4,5-trifluorobenzamide is sourced from PubChem (CID 77036928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).