C12H13F3N2O2 — CID 103896382
N-(5-amino-5-oxopentyl)-3,4,5-trifluorobenzamide (PubChem CID 103896382) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is N-(5-amino-5-oxopentyl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(5-amino-5-oxopentyl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 103896382 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-(5-amino-5-oxopentyl)-3,4,5-trifluorobenzamide |
| SMILES | NC(=O)CCCCNC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H13F3N2O2/c13-8-5-7(6-9(14)11(8)15)12(19)17-4-2-1-3-10(16)18/h5-6H,1-4H2,(H2,16,18)(H,17,19) |
| InChIKey | UHFHTOITOOVNSD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|