C10H7F6NO — CID 55175919
3,4,5-trifluoro-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 55175919) has the molecular formula C10H7F6NO and a molecular weight of 271.16 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 3,4,5-trifluoro-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 55175919 |
| Molecular Formula | C10H7F6NO |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 3,4,5-trifluoro-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | O=C(NCCC(F)(F)F)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H7F6NO/c11-6-3-5(4-7(12)8(6)13)9(18)17-2-1-10(14,15)16/h3-4H,1-2H2,(H,17,18) |
| InChIKey | ABOSCCVRRKFSPR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|