C13H17F3N2O — CID 106139619
N-(4-amino-2,2-dimethylbutyl)-3,4,5-trifluorobenzamide (PubChem CID 106139619) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is N-(4-amino-2,2-dimethylbutyl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(4-amino-2,2-dimethylbutyl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 106139619 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-(4-amino-2,2-dimethylbutyl)-3,4,5-trifluorobenzamide |
| SMILES | CC(C)(CCN)CNC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H17F3N2O/c1-13(2,3-4-17)7-18-12(19)8-5-9(14)11(16)10(15)6-8/h5-6H,3-4,7,17H2,1-2H3,(H,18,19) |
| InChIKey | DWEJNVWHCKTICD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|