C13H18F2N2O — CID 103464640
4-amino-N-(2,2-dimethylbutyl)-3,5-difluorobenzamide (PubChem CID 103464640) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-amino-N-(2,2-dimethylbutyl)-3,5-difluorobenzamide.
| Compound Name | 4-amino-N-(2,2-dimethylbutyl)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 103464640 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 4-amino-N-(2,2-dimethylbutyl)-3,5-difluorobenzamide |
| SMILES | CCC(C)(C)CNC(=O)c1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C13H18F2N2O/c1-4-13(2,3)7-17-12(18)8-5-9(14)11(16)10(15)6-8/h5-6H,4,7,16H2,1-3H3,(H,17,18) |
| InChIKey | SJIWSKQXUOMFGH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|