C14H17ClF3NO — CID 106253344
N-[2-(chloromethyl)-2-ethylbutyl]-3,4,5-trifluorobenzamide (PubChem CID 106253344) has the molecular formula C14H17ClF3NO and a molecular weight of 307.74 g/mol. Its IUPAC name is N-[2-(chloromethyl)-2-ethylbutyl]-3,4,5-trifluorobenzamide.
| Compound Name | N-[2-(chloromethyl)-2-ethylbutyl]-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 106253344 |
| Molecular Formula | C14H17ClF3NO |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[2-(chloromethyl)-2-ethylbutyl]-3,4,5-trifluorobenzamide |
| SMILES | CCC(CC)(CCl)CNC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H17ClF3NO/c1-3-14(4-2,7-15)8-19-13(20)9-5-10(16)12(18)11(17)6-9/h5-6H,3-4,7-8H2,1-2H3,(H,19,20) |
| InChIKey | FWSMNPOYBLRHGR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|