C11H18ClN3O — CID 106253346
N-[2-(chloromethyl)-2-ethylbutyl]-1H-pyrazole-4-carboxamide (PubChem CID 106253346) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is N-[2-(chloromethyl)-2-ethylbutyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[2-(chloromethyl)-2-ethylbutyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 106253346 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-[2-(chloromethyl)-2-ethylbutyl]-1H-pyrazole-4-carboxamide |
| SMILES | CCC(CC)(CCl)CNC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C11H18ClN3O/c1-3-11(4-2,7-12)8-13-10(16)9-5-14-15-6-9/h5-6H,3-4,7-8H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | HQLXLNCRDIUAHN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|