C6H9N3O2 — CID 154047785
N-(methoxymethyl)-1H-pyrazole-4-carboxamide (PubChem CID 154047785) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is N-(methoxymethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(methoxymethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 154047785 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-(methoxymethyl)-1H-pyrazole-4-carboxamide |
| SMILES | COCNC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C6H9N3O2/c1-11-4-7-6(10)5-2-8-9-3-5/h2-3H,4H2,1H3,(H,7,10)(H,8,9) |
| InChIKey | WFEKLXRYFVANBE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|