C10H17N3O3 — CID 43533016
N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide (PubChem CID 43533016) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43533016 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-1H-pyrazole-4-carboxamide |
| SMILES | COCCN(CCOC)C(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H17N3O3/c1-15-5-3-13(4-6-16-2)10(14)9-7-11-12-8-9/h7-8H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | OQFYLOMTBUOANP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |