C8H11N5O3 — CID 62923169
N,N-bis(2-amino-2-oxoethyl)-1H-pyrazole-4-carboxamide (PubChem CID 62923169) has the molecular formula C8H11N5O3 and a molecular weight of 225.21 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 62923169 |
| Molecular Formula | C8H11N5O3 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C8H11N5O3/c9-6(14)3-13(4-7(10)15)8(16)5-1-11-12-2-5/h1-2H,3-4H2,(H2,9,14)(H2,10,15)(H,11,12) |
| InChIKey | VFKHTTMKJWDHRX-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |