C16H13N3O — CID 91240587
N,N-diphenyl-1H-pyrazole-4-carboxamide (PubChem CID 91240587) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is N,N-diphenyl-1H-pyrazole-4-carboxamide.
| Compound Name | N,N-diphenyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 91240587 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N,N-diphenyl-1H-pyrazole-4-carboxamide |
| SMILES | O=C(c1cn[nH]c1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H13N3O/c20-16(13-11-17-18-12-13)19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12H,(H,17,18) |
| InChIKey | NTUSSWUMCQVJQT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |