C16H14N2O2 — CID 174549256
1,1'-biphenyl;1H-pyrazole-4-carboxylic acid (PubChem CID 174549256) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1,1'-biphenyl;1H-pyrazole-4-carboxylic acid.
| Compound Name | 1,1'-biphenyl;1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 174549256 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1,1'-biphenyl;1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H4N2O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-4(8)3-1-5-6-2-3/h1-10H;1-2H,(H,5,6)(H,7,8) |
| InChIKey | VNGVAZJPBGGYRO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |