C12H13N3O2 — CID 113356455
N-[(1S)-2-hydroxy-1-phenylethyl]-1H-pyrazole-4-carboxamide (PubChem CID 113356455) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is N-[(1S)-2-hydroxy-1-phenylethyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(1S)-2-hydroxy-1-phenylethyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 113356455 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-[(1S)-2-hydroxy-1-phenylethyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(N[C@H](CO)c1ccccc1)c1cn[nH]c1 |
| InChI | InChI=1S/C12H13N3O2/c16-8-11(9-4-2-1-3-5-9)15-12(17)10-6-13-14-7-10/h1-7,11,16H,8H2,(H,13,14)(H,15,17)/t11-/m1/s1 |
| InChIKey | DCQIIWUCNKQUNB-LLVKDONJSA-N |
| XLogP | 0.87 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |