C16H16N2O3 — CID 63182176
4-N-(2-hydroxy-1-phenylethyl)benzene-1,4-dicarboxamide (PubChem CID 63182176) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-N-(2-hydroxy-1-phenylethyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(2-hydroxy-1-phenylethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 63182176 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-N-(2-hydroxy-1-phenylethyl)benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)NC(CO)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N2O3/c17-15(20)12-6-8-13(9-7-12)16(21)18-14(10-19)11-4-2-1-3-5-11/h1-9,14,19H,10H2,(H2,17,20)(H,18,21) |
| InChIKey | ISFJNZGLLMNFQQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |