C26H28N2O2 — CID 43912072
1-N,4-N-bis(1-phenylpropyl)benzene-1,4-dicarboxamide (PubChem CID 43912072) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-N,4-N-bis(1-phenylpropyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(1-phenylpropyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 43912072 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-N,4-N-bis(1-phenylpropyl)benzene-1,4-dicarboxamide |
| SMILES | CCC(NC(=O)c1ccc(C(=O)NC(CC)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O2/c1-3-23(19-11-7-5-8-12-19)27-25(29)21-15-17-22(18-16-21)26(30)28-24(4-2)20-13-9-6-10-14-20/h5-18,23-24H,3-4H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | HAVFWXOXPWUADG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |