C23H31NO2 — CID 43911534
4-heptoxy-N-(1-phenylpropyl)benzamide (PubChem CID 43911534) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-heptoxy-N-(1-phenylpropyl)benzamide.
| Compound Name | 4-heptoxy-N-(1-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 43911534 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 4-heptoxy-N-(1-phenylpropyl)benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(CC)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H31NO2/c1-3-5-6-7-11-18-26-21-16-14-20(15-17-21)23(25)24-22(4-2)19-12-9-8-10-13-19/h8-10,12-17,22H,3-7,11,18H2,1-2H3,(H,24,25) |
| InChIKey | RNHHITJKJUJNHM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|