C33H40O4 — CID 3785979
1,5-bis(4-pentoxyphenyl)-3-phenylpentane-1,5-dione (PubChem CID 3785979) has the molecular formula C33H40O4 and a molecular weight of 500.68 g/mol. Its IUPAC name is 1,5-bis(4-pentoxyphenyl)-3-phenylpentane-1,5-dione.
| Compound Name | 1,5-bis(4-pentoxyphenyl)-3-phenylpentane-1,5-dione |
|---|---|
| PubChem CID | 3785979 |
| Molecular Formula | C33H40O4 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | 1,5-bis(4-pentoxyphenyl)-3-phenylpentane-1,5-dione |
| SMILES | CCCCCOc1ccc(C(=O)CC(CC(=O)c2ccc(OCCCCC)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H40O4/c1-3-5-10-22-36-30-18-14-27(15-19-30)32(34)24-29(26-12-8-7-9-13-26)25-33(35)28-16-20-31(21-17-28)37-23-11-6-4-2/h7-9,12-21,29H,3-6,10-11,22-25H2,1-2H3 |
| InChIKey | UVDDSHKURWQSGT-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|