C42H58O6 — CID 19742408
[2-(4-decoxybenzoyl)oxy-2-phenylethyl] 4-decoxybenzoate (PubChem CID 19742408) has the molecular formula C42H58O6 and a molecular weight of 658.92 g/mol. Its IUPAC name is [2-(4-decoxybenzoyl)oxy-2-phenylethyl] 4-decoxybenzoate.
| Compound Name | [2-(4-decoxybenzoyl)oxy-2-phenylethyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 19742408 |
| Molecular Formula | C42H58O6 |
| Molecular Weight | 658.92 g/mol |
| Exact Mass | 658.42 |
| IUPAC Name | [2-(4-decoxybenzoyl)oxy-2-phenylethyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)OCC(OC(=O)c2ccc(OCCCCCCCCCC)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H58O6/c1-3-5-7-9-11-13-15-20-32-45-38-28-24-36(25-29-38)41(43)47-34-40(35-22-18-17-19-23-35)48-42(44)37-26-30-39(31-27-37)46-33-21-16-14-12-10-8-6-4-2/h17-19,22-31,40H,3-16,20-21,32-34H2,1-2H3 |
| InChIKey | DSBNJLOFGPOUBU-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.92 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|