C46H46O10 — CID 19742439
[4-[2-[4-(4-pentoxybenzoyl)oxybenzoyl]oxy-2-phenylethoxy]carbonylphenyl] 4-pentoxybenzoate (PubChem CID 19742439) has the molecular formula C46H46O10 and a molecular weight of 758.86 g/mol. Its IUPAC name is [4-[2-[4-(4-pentoxybenzoyl)oxybenzoyl]oxy-2-phenylethoxy]carbonylphenyl] 4-pentoxybenzoate.
| Compound Name | [4-[2-[4-(4-pentoxybenzoyl)oxybenzoyl]oxy-2-phenylethoxy]carbonylphenyl] 4-pentoxybenzoate |
|---|---|
| PubChem CID | 19742439 |
| Molecular Formula | C46H46O10 |
| Molecular Weight | 758.86 g/mol |
| Exact Mass | 758.31 |
| IUPAC Name | [4-[2-[4-(4-pentoxybenzoyl)oxybenzoyl]oxy-2-phenylethoxy]carbonylphenyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(C(=O)OCC(OC(=O)c3ccc(OC(=O)c4ccc(OCCCCC)cc4)cc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C46H46O10/c1-3-5-10-30-51-38-22-14-35(15-23-38)44(48)54-40-26-18-34(19-27-40)43(47)53-32-42(33-12-8-7-9-13-33)56-46(50)37-20-28-41(29-21-37)55-45(49)36-16-24-39(25-17-36)52-31-11-6-4-2/h7-9,12-29,42H,3-6,10-11,30-32H2,1-2H3 |
| InChIKey | HXCGZHNKRVXJBN-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.86 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|