C54H78O6 — CID 54032059
[(2R)-2-[4-[3-(4-heptylcyclohexyl)propoxy]benzoyl]oxy-2-phenylethyl] 4-[3-(4-heptylcyclohexyl)propoxy]benzoate (PubChem CID 54032059) has the molecular formula C54H78O6 and a molecular weight of 823.21 g/mol. Its IUPAC name is [(2R)-2-[4-[3-(4-heptylcyclohexyl)propoxy]benzoyl]oxy-2-phenylethyl] 4-[3-(4-heptylcyclohexyl)propoxy]benzoate.
| Compound Name | [(2R)-2-[4-[3-(4-heptylcyclohexyl)propoxy]benzoyl]oxy-2-phenylethyl] 4-[3-(4-heptylcyclohexyl)propoxy]benzoate |
|---|---|
| PubChem CID | 54032059 |
| Molecular Formula | C54H78O6 |
| Molecular Weight | 823.21 g/mol |
| Exact Mass | 822.58 |
| IUPAC Name | [(2R)-2-[4-[3-(4-heptylcyclohexyl)propoxy]benzoyl]oxy-2-phenylethyl] 4-[3-(4-heptylcyclohexyl)propoxy]benzoate |
| SMILES | CCCCCCCC1CCC(CCCOc2ccc(C(=O)OC[C@H](OC(=O)c3ccc(OCCCC4CCC(CCCCCCC)CC4)cc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C54H78O6/c1-3-5-7-9-12-18-43-24-28-45(29-25-43)20-16-40-57-50-36-32-48(33-37-50)53(55)59-42-52(47-22-14-11-15-23-47)60-54(56)49-34-38-51(39-35-49)58-41-17-21-46-30-26-44(27-31-46)19-13-10-8-6-4-2/h11,14-15,22-23,32-39,43-46,52H,3-10,12-13,16-21,24-31,40-42H2,1-2H3/t43?,44?,45?,46?,52-/m0/s1 |
| InChIKey | LGHPQKNWNMRAFC-MJQXSBBZSA-N |
| XLogP | 15.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.21 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|