C45H58O4 — CID 129226925
[2-[4-(4-cyclohexylcyclohexyl)benzoyl]oxy-2-phenylethyl] 4-(4-pentylcyclohexyl)benzoate (PubChem CID 129226925) has the molecular formula C45H58O4 and a molecular weight of 662.96 g/mol. Its IUPAC name is [2-[4-(4-cyclohexylcyclohexyl)benzoyl]oxy-2-phenylethyl] 4-(4-pentylcyclohexyl)benzoate.
| Compound Name | [2-[4-(4-cyclohexylcyclohexyl)benzoyl]oxy-2-phenylethyl] 4-(4-pentylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 129226925 |
| Molecular Formula | C45H58O4 |
| Molecular Weight | 662.96 g/mol |
| Exact Mass | 662.43 |
| IUPAC Name | [2-[4-(4-cyclohexylcyclohexyl)benzoyl]oxy-2-phenylethyl] 4-(4-pentylcyclohexyl)benzoate |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)OCC(OC(=O)c3ccc(C4CCC(C5CCCCC5)CC4)cc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C45H58O4/c1-2-3-6-11-33-16-18-35(19-17-33)38-24-28-41(29-25-38)44(46)48-32-43(40-14-9-5-10-15-40)49-45(47)42-30-26-39(27-31-42)37-22-20-36(21-23-37)34-12-7-4-8-13-34/h5,9-10,14-15,24-31,33-37,43H,2-4,6-8,11-13,16-23,32H2,1H3 |
| InChIKey | SOQWCTIAUJCULJ-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.96 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|