C19H26F2O2 — CID 67808515
1,2-difluoroethyl 4-(4-butylcyclohexyl)benzoate (PubChem CID 67808515) has the molecular formula C19H26F2O2 and a molecular weight of 324.41 g/mol. Its IUPAC name is 1,2-difluoroethyl 4-(4-butylcyclohexyl)benzoate.
| Compound Name | 1,2-difluoroethyl 4-(4-butylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 67808515 |
| Molecular Formula | C19H26F2O2 |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 1,2-difluoroethyl 4-(4-butylcyclohexyl)benzoate |
| SMILES | CCCCC1CCC(c2ccc(C(=O)OC(F)CF)cc2)CC1 |
| InChI | InChI=1S/C19H26F2O2/c1-2-3-4-14-5-7-15(8-6-14)16-9-11-17(12-10-16)19(22)23-18(21)13-20/h9-12,14-15,18H,2-8,13H2,1H3 |
| InChIKey | ZKJFEMIWWGDEGJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |