C28H35F3O2 — CID 19825323
(2,2,2-trifluoro-1-phenylethyl) 4-(4-heptylcyclohexyl)benzoate (PubChem CID 19825323) has the molecular formula C28H35F3O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (2,2,2-trifluoro-1-phenylethyl) 4-(4-heptylcyclohexyl)benzoate.
| Compound Name | (2,2,2-trifluoro-1-phenylethyl) 4-(4-heptylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 19825323 |
| Molecular Formula | C28H35F3O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | (2,2,2-trifluoro-1-phenylethyl) 4-(4-heptylcyclohexyl)benzoate |
| SMILES | CCCCCCCC1CCC(c2ccc(C(=O)OC(c3ccccc3)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C28H35F3O2/c1-2-3-4-5-7-10-21-13-15-22(16-14-21)23-17-19-25(20-18-23)27(32)33-26(28(29,30)31)24-11-8-6-9-12-24/h6,8-9,11-12,17-22,26H,2-5,7,10,13-16H2,1H3 |
| InChIKey | FWXLNLPYNLQDPM-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|