C44H62O8 — CID 18641737
dimethyl (3R,4R)-3,4-bis[[4-(4-pentylcyclohexyl)benzoyl]oxy]hexanedioate (PubChem CID 18641737) has the molecular formula C44H62O8 and a molecular weight of 718.97 g/mol. Its IUPAC name is dimethyl (3R,4R)-3,4-bis[[4-(4-pentylcyclohexyl)benzoyl]oxy]hexanedioate.
| Compound Name | dimethyl (3R,4R)-3,4-bis[[4-(4-pentylcyclohexyl)benzoyl]oxy]hexanedioate |
|---|---|
| PubChem CID | 18641737 |
| Molecular Formula | C44H62O8 |
| Molecular Weight | 718.97 g/mol |
| Exact Mass | 718.44 |
| IUPAC Name | dimethyl (3R,4R)-3,4-bis[[4-(4-pentylcyclohexyl)benzoyl]oxy]hexanedioate |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)O[C@H](CC(=O)OC)[C@@H](CC(=O)OC)OC(=O)c3ccc(C4CCC(CCCCC)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C44H62O8/c1-5-7-9-11-31-13-17-33(18-14-31)35-21-25-37(26-22-35)43(47)51-39(29-41(45)49-3)40(30-42(46)50-4)52-44(48)38-27-23-36(24-28-38)34-19-15-32(16-20-34)12-10-8-6-2/h21-28,31-34,39-40H,5-20,29-30H2,1-4H3/t31?,32?,33?,34?,39-,40-/m1/s1 |
| InChIKey | XTRPQKJTOUBQCX-SHROVVJLSA-N |
| XLogP | 10.27 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.97 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|