About 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate
3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate (PubChem CID 67825599) has the molecular formula C27H38O3
and a molecular weight of 410.60 g/mol. Its IUPAC name is 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate.
Molecular Properties
| Compound Name | 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate |
| PubChem CID | 67825599 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate |
| SMILES | CC#CC(=O)C(C)OC(=O)c1ccc(C2CCC(CCCCCCCC)CC2)cc1 |
| InChI | InChI=1S/C27H38O3/c1-4-6-7-8-9-10-12-22-13-15-23(16-14-22)24-17-19-25(20-18-24)27(29)30-21(3)26(28)11-5-2/h17-23H,4,6-10,12-16H2,1-3H3 |
| InChIKey | ZBJRQOIDZWAWEG-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate?
The IUPAC name of 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate (CID 67825599) is 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate.
What is the SMILES notation for 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate?
The canonical SMILES for 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate is CC#CC(=O)C(C)OC(=O)c1ccc(C2CCC(CCCCCCCC)CC2)cc1.
What is the InChIKey of 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate?
The InChIKey is ZBJRQOIDZWAWEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H38O3/c1-4-6-7-8-9-10-12-22-13-15-23(16-14-22)24-17-19-25(20-18-24)27(29)30-21(3)26(28)11-5-2/h17-23H,4,6-10,12-16H2,1-3H3.
What are the key properties of 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate?
3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate has a molecular weight of 410.60 g/mol, XLogP of 6.85, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxohex-4-yn-2-yl 4-(4-octylcyclohexyl)benzoate is sourced from PubChem (CID 67825599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).