C31H48O3 — CID 40617742
[(2R)-1-oxo-1-[4-(4-propylcyclohexyl)phenyl]propan-2-yl] 4-hexylcyclohexane-1-carboxylate (PubChem CID 40617742) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[4-(4-propylcyclohexyl)phenyl]propan-2-yl] 4-hexylcyclohexane-1-carboxylate.
| Compound Name | [(2R)-1-oxo-1-[4-(4-propylcyclohexyl)phenyl]propan-2-yl] 4-hexylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 40617742 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | [(2R)-1-oxo-1-[4-(4-propylcyclohexyl)phenyl]propan-2-yl] 4-hexylcyclohexane-1-carboxylate |
| SMILES | CCCCCCC1CCC(C(=O)O[C@H](C)C(=O)c2ccc(C3CCC(CCC)CC3)cc2)CC1 |
| InChI | InChI=1S/C31H48O3/c1-4-6-7-8-10-25-13-17-29(18-14-25)31(33)34-23(3)30(32)28-21-19-27(20-22-28)26-15-11-24(9-5-2)12-16-26/h19-26,29H,4-18H2,1-3H3/t23-,24?,25?,26?,29?/m1/s1 |
| InChIKey | RIBUMDJPKGRNIT-OAUUCWLZSA-N |
| XLogP | 8.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|