About (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate
(4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate (PubChem CID 23334748) has the molecular formula C29H46O2
and a molecular weight of 426.69 g/mol. Its IUPAC name is (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate.
Molecular Properties
| Compound Name | (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate |
| PubChem CID | 23334748 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate |
| SMILES | CCCCCC1CCC(OC(=O)c2ccc(C3CCC(CC(C)CC)CC3)cc2)CC1 |
| InChI | InChI=1S/C29H46O2/c1-4-6-7-8-23-11-19-28(20-12-23)31-29(30)27-17-15-26(16-18-27)25-13-9-24(10-14-25)21-22(3)5-2/h15-18,22-25,28H,4-14,19-21H2,1-3H3 |
| InChIKey | AIQQTIOKCIZWTE-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate?
The IUPAC name of (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate (CID 23334748) is (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate.
What is the SMILES notation for (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate?
The canonical SMILES for (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate is CCCCCC1CCC(OC(=O)c2ccc(C3CCC(CC(C)CC)CC3)cc2)CC1.
What is the InChIKey of (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate?
The InChIKey is AIQQTIOKCIZWTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H46O2/c1-4-6-7-8-23-11-19-28(20-12-23)31-29(30)27-17-15-26(16-18-27)25-13-9-24(10-14-25)21-22(3)5-2/h15-18,22-25,28H,4-14,19-21H2,1-3H3.
What are the key properties of (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate?
(4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate has a molecular weight of 426.69 g/mol, XLogP of 8.69, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pentylcyclohexyl) 4-[4-(2-methylbutyl)cyclohexyl]benzoate is sourced from PubChem (CID 23334748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).