C34H48O5 — CID 67912932
[4-(4-pentylcyclohexyl)oxycarbonylphenyl] 4-(6-methyloctoxy)benzoate (PubChem CID 67912932) has the molecular formula C34H48O5 and a molecular weight of 536.75 g/mol. Its IUPAC name is [4-(4-pentylcyclohexyl)oxycarbonylphenyl] 4-(6-methyloctoxy)benzoate.
| Compound Name | [4-(4-pentylcyclohexyl)oxycarbonylphenyl] 4-(6-methyloctoxy)benzoate |
|---|---|
| PubChem CID | 67912932 |
| Molecular Formula | C34H48O5 |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | [4-(4-pentylcyclohexyl)oxycarbonylphenyl] 4-(6-methyloctoxy)benzoate |
| SMILES | CCCCCC1CCC(OC(=O)c2ccc(OC(=O)c3ccc(OCCCCCC(C)CC)cc3)cc2)CC1 |
| InChI | InChI=1S/C34H48O5/c1-4-6-8-12-27-13-19-31(20-14-27)38-34(36)29-17-23-32(24-18-29)39-33(35)28-15-21-30(22-16-28)37-25-10-7-9-11-26(3)5-2/h15-18,21-24,26-27,31H,4-14,19-20,25H2,1-3H3 |
| InChIKey | DVLZHOAYUKGLFB-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|