C32H46O5 — CID 57136920
[4-(5-octyl-1,3-dioxan-2-yl)phenyl] 4-(4-methylhexoxy)benzoate (PubChem CID 57136920) has the molecular formula C32H46O5 and a molecular weight of 510.72 g/mol. Its IUPAC name is [4-(5-octyl-1,3-dioxan-2-yl)phenyl] 4-(4-methylhexoxy)benzoate.
| Compound Name | [4-(5-octyl-1,3-dioxan-2-yl)phenyl] 4-(4-methylhexoxy)benzoate |
|---|---|
| PubChem CID | 57136920 |
| Molecular Formula | C32H46O5 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | [4-(5-octyl-1,3-dioxan-2-yl)phenyl] 4-(4-methylhexoxy)benzoate |
| SMILES | CCCCCCCCC1COC(c2ccc(OC(=O)c3ccc(OCCCC(C)CC)cc3)cc2)OC1 |
| InChI | InChI=1S/C32H46O5/c1-4-6-7-8-9-10-13-26-23-35-32(36-24-26)28-16-20-30(21-17-28)37-31(33)27-14-18-29(19-15-27)34-22-11-12-25(3)5-2/h14-21,25-26,32H,4-13,22-24H2,1-3H3 |
| InChIKey | KDUCVMFGYIXSLE-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|