About 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane
5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane (PubChem CID 19834752) has the molecular formula C29H40O3
and a molecular weight of 436.64 g/mol. Its IUPAC name is 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane |
| PubChem CID | 19834752 |
| Molecular Formula | C29H40O3 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane |
| SMILES | C=CCCCCC1COC(c2ccc(-c3ccc(OCCCC(C)CC)cc3)cc2)OC1 |
| InChI | InChI=1S/C29H40O3/c1-4-6-7-8-11-24-21-31-29(32-22-24)27-14-12-25(13-15-27)26-16-18-28(19-17-26)30-20-9-10-23(3)5-2/h4,12-19,23-24,29H,1,5-11,20-22H2,2-3H3 |
| InChIKey | QFODPXKBXSTFLQ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane?
The IUPAC name of 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane (CID 19834752) is 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane.
What is the SMILES notation for 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane?
The canonical SMILES for 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane is C=CCCCCC1COC(c2ccc(-c3ccc(OCCCC(C)CC)cc3)cc2)OC1.
What is the InChIKey of 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane?
The InChIKey is QFODPXKBXSTFLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H40O3/c1-4-6-7-8-11-24-21-31-29(32-22-24)27-14-12-25(13-15-27)26-16-18-28(19-17-26)30-20-9-10-23(3)5-2/h4,12-19,23-24,29H,1,5-11,20-22H2,2-3H3.
What are the key properties of 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane?
5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane has a molecular weight of 436.64 g/mol, XLogP of 7.97, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hex-5-enyl-2-[4-[4-(4-methylhexoxy)phenyl]phenyl]-1,3-dioxane is sourced from PubChem (CID 19834752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).