C33H48O3 — CID 19834815
5-non-8-enyl-2-[4-(4-octan-2-yloxyphenyl)phenyl]-1,3-dioxane (PubChem CID 19834815) has the molecular formula C33H48O3 and a molecular weight of 492.74 g/mol. Its IUPAC name is 5-non-8-enyl-2-[4-(4-octan-2-yloxyphenyl)phenyl]-1,3-dioxane.
| Compound Name | 5-non-8-enyl-2-[4-(4-octan-2-yloxyphenyl)phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 19834815 |
| Molecular Formula | C33H48O3 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.36 |
| IUPAC Name | 5-non-8-enyl-2-[4-(4-octan-2-yloxyphenyl)phenyl]-1,3-dioxane |
| SMILES | C=CCCCCCCCC1COC(c2ccc(-c3ccc(OC(C)CCCCCC)cc3)cc2)OC1 |
| InChI | InChI=1S/C33H48O3/c1-4-6-8-10-11-12-14-16-28-25-34-33(35-26-28)31-19-17-29(18-20-31)30-21-23-32(24-22-30)36-27(3)15-13-9-7-5-2/h4,17-24,27-28,33H,1,5-16,25-26H2,2-3H3 |
| InChIKey | LJSQHMIPBWSDAB-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|