C30H42O3 — CID 18645079
5-hex-5-enyl-2-[4-[4-[(2S)-octan-2-yl]oxyphenyl]phenyl]-1,3-dioxane (PubChem CID 18645079) has the molecular formula C30H42O3 and a molecular weight of 450.66 g/mol. Its IUPAC name is 5-hex-5-enyl-2-[4-[4-[(2S)-octan-2-yl]oxyphenyl]phenyl]-1,3-dioxane.
| Compound Name | 5-hex-5-enyl-2-[4-[4-[(2S)-octan-2-yl]oxyphenyl]phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 18645079 |
| Molecular Formula | C30H42O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 5-hex-5-enyl-2-[4-[4-[(2S)-octan-2-yl]oxyphenyl]phenyl]-1,3-dioxane |
| SMILES | C=CCCCCC1COC(c2ccc(-c3ccc(O[C@@H](C)CCCCCC)cc3)cc2)OC1 |
| InChI | InChI=1S/C30H42O3/c1-4-6-8-10-12-24(3)33-29-20-18-27(19-21-29)26-14-16-28(17-15-26)30-31-22-25(23-32-30)13-11-9-7-5-2/h5,14-21,24-25,30H,2,4,6-13,22-23H2,1,3H3/t24-,25?,30?/m0/s1 |
| InChIKey | QNAOIWRCVYEMMD-JTYFBONFSA-N |
| XLogP | 8.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|