C23H28O2 — CID 59498812
5-hex-5-enyl-2-[4-(4-methylphenyl)phenyl]-1,3-dioxane (PubChem CID 59498812) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 5-hex-5-enyl-2-[4-(4-methylphenyl)phenyl]-1,3-dioxane.
| Compound Name | 5-hex-5-enyl-2-[4-(4-methylphenyl)phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 59498812 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 5-hex-5-enyl-2-[4-(4-methylphenyl)phenyl]-1,3-dioxane |
| SMILES | C=CCCCCC1COC(c2ccc(-c3ccc(C)cc3)cc2)OC1 |
| InChI | InChI=1S/C23H28O2/c1-3-4-5-6-7-19-16-24-23(25-17-19)22-14-12-21(13-15-22)20-10-8-18(2)9-11-20/h3,8-15,19,23H,1,4-7,16-17H2,2H3 |
| InChIKey | LXXBHDQFRWWJSD-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|