C17H20O2 — CID 19781293
5-but-3-enyl-2-(4-prop-1-ynylphenyl)-1,3-dioxane (PubChem CID 19781293) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 5-but-3-enyl-2-(4-prop-1-ynylphenyl)-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-(4-prop-1-ynylphenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 19781293 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 5-but-3-enyl-2-(4-prop-1-ynylphenyl)-1,3-dioxane |
| SMILES | C=CCCC1COC(c2ccc(C#CC)cc2)OC1 |
| InChI | InChI=1S/C17H20O2/c1-3-5-7-15-12-18-17(19-13-15)16-10-8-14(6-4-2)9-11-16/h3,8-11,15,17H,1,5,7,12-13H2,2H3 |
| InChIKey | HTSQOTWXPYZTFZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|