C20H25FO2 — CID 22876124
5-but-3-enyl-2-[4-(4-fluorocyclohex-3-en-1-yl)phenyl]-1,3-dioxane (PubChem CID 22876124) has the molecular formula C20H25FO2 and a molecular weight of 316.42 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-(4-fluorocyclohex-3-en-1-yl)phenyl]-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-[4-(4-fluorocyclohex-3-en-1-yl)phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22876124 |
| Molecular Formula | C20H25FO2 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 5-but-3-enyl-2-[4-(4-fluorocyclohex-3-en-1-yl)phenyl]-1,3-dioxane |
| SMILES | C=CCCC1COC(c2ccc(C3CC=C(F)CC3)cc2)OC1 |
| InChI | InChI=1S/C20H25FO2/c1-2-3-4-15-13-22-20(23-14-15)18-7-5-16(6-8-18)17-9-11-19(21)12-10-17/h2,5-8,11,15,17,20H,1,3-4,9-10,12-14H2 |
| InChIKey | KUAGYESCDIOINB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|