C21H27FO2 — CID 22876128
2-[4-(4-fluorocyclohex-3-en-1-yl)phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane (PubChem CID 22876128) has the molecular formula C21H27FO2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 2-[4-(4-fluorocyclohex-3-en-1-yl)phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane.
| Compound Name | 2-[4-(4-fluorocyclohex-3-en-1-yl)phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22876128 |
| Molecular Formula | C21H27FO2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-[4-(4-fluorocyclohex-3-en-1-yl)phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1COC(c2ccc(C3CC=C(F)CC3)cc2)OC1 |
| InChI | InChI=1S/C21H27FO2/c1-2-3-4-5-16-14-23-21(24-15-16)19-8-6-17(7-9-19)18-10-12-20(22)13-11-18/h2-3,6-9,12,16,18,21H,4-5,10-11,13-15H2,1H3/b3-2+ |
| InChIKey | RLLCPNITAVLNRV-NSCUHMNNSA-N |
| XLogP | 5.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|