C17H27FO2 — CID 54334191
2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-5-pent-3-enyl-1,3-dioxane (PubChem CID 54334191) has the molecular formula C17H27FO2 and a molecular weight of 282.40 g/mol. Its IUPAC name is 2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-5-pent-3-enyl-1,3-dioxane.
| Compound Name | 2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-5-pent-3-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 54334191 |
| Molecular Formula | C17H27FO2 |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 2-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]-5-pent-3-enyl-1,3-dioxane |
| SMILES | CC=CCCC1COC(CCC2CC=C(F)CC2)OC1 |
| InChI | InChI=1S/C17H27FO2/c1-2-3-4-5-15-12-19-17(20-13-15)11-8-14-6-9-16(18)10-7-14/h2-3,9,14-15,17H,4-8,10-13H2,1H3 |
| InChIKey | TUHHNHMHSGZMKC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|