About 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane
5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane (PubChem CID 135303149) has the molecular formula C22H27F3O2
and a molecular weight of 380.45 g/mol. Its IUPAC name is 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane.
Molecular Properties
| Compound Name | 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane |
| PubChem CID | 135303149 |
| Molecular Formula | C22H27F3O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane |
| SMILES | C/C=C/CCC1COC(C2CC=C(c3ccc(C(F)(F)F)cc3)CC2)OC1 |
| InChI | InChI=1S/C22H27F3O2/c1-2-3-4-5-16-14-26-21(27-15-16)19-8-6-17(7-9-19)18-10-12-20(13-11-18)22(23,24)25/h2-3,6,10-13,16,19,21H,4-5,7-9,14-15H2,1H3/b3-2+ |
| InChIKey | LTEOSGYPUDNEPH-NSCUHMNNSA-N |
| XLogP | 6.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane?
The IUPAC name of 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane (CID 135303149) is 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane.
What is the SMILES notation for 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane?
The canonical SMILES for 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane is C/C=C/CCC1COC(C2CC=C(c3ccc(C(F)(F)F)cc3)CC2)OC1.
What is the InChIKey of 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane?
The InChIKey is LTEOSGYPUDNEPH-NSCUHMNNSA-N. The full InChI is InChI=1S/C22H27F3O2/c1-2-3-4-5-16-14-26-21(27-15-16)19-8-6-17(7-9-19)18-10-12-20(13-11-18)22(23,24)25/h2-3,6,10-13,16,19,21H,4-5,7-9,14-15H2,1H3/b3-2+.
What are the key properties of 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane?
5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane has a molecular weight of 380.45 g/mol, XLogP of 6.23, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane is sourced from PubChem (CID 135303149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).