C22H27F3O2 — CID 135303149
5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane (PubChem CID 135303149) has the molecular formula C22H27F3O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane.
| Compound Name | 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 135303149 |
| Molecular Formula | C22H27F3O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5-[(E)-pent-3-enyl]-2-[4-[4-(trifluoromethyl)phenyl]cyclohex-3-en-1-yl]-1,3-dioxane |
| SMILES | C/C=C/CCC1COC(C2CC=C(c3ccc(C(F)(F)F)cc3)CC2)OC1 |
| InChI | InChI=1S/C22H27F3O2/c1-2-3-4-5-16-14-26-21(27-15-16)19-8-6-17(7-9-19)18-10-12-20(13-11-18)22(23,24)25/h2-3,6,10-13,16,19,21H,4-5,7-9,14-15H2,1H3/b3-2+ |
| InChIKey | LTEOSGYPUDNEPH-NSCUHMNNSA-N |
| XLogP | 6.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|