C22H29F3 — CID 126551449
1-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-4-(trifluoromethyl)benzene (PubChem CID 126551449) has the molecular formula C22H29F3 and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 126551449 |
| Molecular Formula | C22H29F3 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 1-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-4-(trifluoromethyl)benzene |
| SMILES | CCCC1CCC(C2CC=C(c3ccc(C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H29F3/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-14-21(15-13-20)22(23,24)25/h10,12-18H,2-9,11H2,1H3 |
| InChIKey | ITRLAFDPRWOXOC-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |