C23H33F3N2 — CID 100994058
N-ethyl-5-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-N-(trifluoromethyl)pyridin-2-amine (PubChem CID 100994058) has the molecular formula C23H33F3N2 and a molecular weight of 394.53 g/mol. Its IUPAC name is N-ethyl-5-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-N-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-ethyl-5-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-N-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 100994058 |
| Molecular Formula | C23H33F3N2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | N-ethyl-5-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-N-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCC1CCC(C2CC=C(c3ccc(N(CC)C(F)(F)F)nc3)CC2)CC1 |
| InChI | InChI=1S/C23H33F3N2/c1-3-5-17-6-8-18(9-7-17)19-10-12-20(13-11-19)21-14-15-22(27-16-21)28(4-2)23(24,25)26/h12,14-19H,3-11,13H2,1-2H3 |
| InChIKey | JFIYOWRRYVQWFY-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|