C21H27F3 — CID 86326322
1,2,3-trifluoro-5-[(4R)-4-(4-propylcyclohexyl)cyclohexen-1-yl]benzene (PubChem CID 86326322) has the molecular formula C21H27F3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[(4R)-4-(4-propylcyclohexyl)cyclohexen-1-yl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[(4R)-4-(4-propylcyclohexyl)cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 86326322 |
| Molecular Formula | C21H27F3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 1,2,3-trifluoro-5-[(4R)-4-(4-propylcyclohexyl)cyclohexen-1-yl]benzene |
| SMILES | CCCC1CCC([C@H]2CC=C(c3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C21H27F3/c1-2-3-14-4-6-15(7-5-14)16-8-10-17(11-9-16)18-12-19(22)21(24)20(23)13-18/h10,12-16H,2-9,11H2,1H3/t14?,15?,16-/m0/s1 |
| InChIKey | OMTDXPFPYPQYMA-GPANFISMSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|