C22H28F4O — CID 165341497
2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-1-(trifluoromethoxy)benzene (PubChem CID 165341497) has the molecular formula C22H28F4O and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-1-(trifluoromethoxy)benzene.
| Compound Name | 2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 165341497 |
| Molecular Formula | C22H28F4O |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 2-fluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-1-(trifluoromethoxy)benzene |
| SMILES | CCCC1CCC(C2CC=C(c3ccc(OC(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H28F4O/c1-2-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)19-12-13-21(20(23)14-19)27-22(24,25)26/h10,12-17H,2-9,11H2,1H3 |
| InChIKey | WGKVWOHUIRWTLX-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |